C22H32N8O2 — CID 85050931
6-methyl-5-[4-[4-(2-morpholin-4-ylethoxyiminomethyl)phenyl]piperazin-1-yl]pyrimidine-2,4-diamine (PubChem CID 85050931) has the molecular formula C22H32N8O2 and a molecular weight of 440.55 g/mol. Its IUPAC name is 6-methyl-5-[4-[4-(2-morpholin-4-ylethoxyiminomethyl)phenyl]piperazin-1-yl]pyrimidine-2,4-diamine.
| Compound Name | 6-methyl-5-[4-[4-(2-morpholin-4-ylethoxyiminomethyl)phenyl]piperazin-1-yl]pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 85050931 |
| Molecular Formula | C22H32N8O2 |
| Molecular Weight | 440.55 g/mol |
| Exact Mass | 440.26 |
| IUPAC Name | 6-methyl-5-[4-[4-(2-morpholin-4-ylethoxyiminomethyl)phenyl]piperazin-1-yl]pyrimidine-2,4-diamine |
| SMILES | Cc1nc(N)nc(N)c1N1CCN(c2ccc(C=NOCCN3CCOCC3)cc2)CC1 |
| InChI | InChI=1S/C22H32N8O2/c1-17-20(21(23)27-22(24)26-17)30-8-6-29(7-9-30)19-4-2-18(3-5-19)16-25-32-15-12-28-10-13-31-14-11-28/h2-5,16H,6-15H2,1H3,(H4,23,24,26,27) |
| InChIKey | KIIWQDDURKGLQK-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 118.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.55 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|