C19H30N4O3 — CID 110292016
ethyl N-[4-[4-(2-morpholin-4-ylethyl)piperazin-1-yl]phenyl]carbamate (PubChem CID 110292016) has the molecular formula C19H30N4O3 and a molecular weight of 362.47 g/mol. Its IUPAC name is ethyl N-[4-[4-(2-morpholin-4-ylethyl)piperazin-1-yl]phenyl]carbamate.
| Compound Name | ethyl N-[4-[4-(2-morpholin-4-ylethyl)piperazin-1-yl]phenyl]carbamate |
|---|---|
| PubChem CID | 110292016 |
| Molecular Formula | C19H30N4O3 |
| Molecular Weight | 362.47 g/mol |
| Exact Mass | 362.23 |
| IUPAC Name | ethyl N-[4-[4-(2-morpholin-4-ylethyl)piperazin-1-yl]phenyl]carbamate |
| SMILES | CCOC(=O)Nc1ccc(N2CCN(CCN3CCOCC3)CC2)cc1 |
| InChI | InChI=1S/C19H30N4O3/c1-2-26-19(24)20-17-3-5-18(6-4-17)23-11-9-21(10-12-23)7-8-22-13-15-25-16-14-22/h3-6H,2,7-16H2,1H3,(H,20,24) |
| InChIKey | WKYJJASSESCQIH-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 57.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.47 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|