C18H24N6O2 — CID 113049859
ethyl N-[6-[4-(4-methylpiperazin-1-yl)anilino]pyridazin-3-yl]carbamate (PubChem CID 113049859) has the molecular formula C18H24N6O2 and a molecular weight of 356.43 g/mol. Its IUPAC name is ethyl N-[6-[4-(4-methylpiperazin-1-yl)anilino]pyridazin-3-yl]carbamate.
| Compound Name | ethyl N-[6-[4-(4-methylpiperazin-1-yl)anilino]pyridazin-3-yl]carbamate |
|---|---|
| PubChem CID | 113049859 |
| Molecular Formula | C18H24N6O2 |
| Molecular Weight | 356.43 g/mol |
| Exact Mass | 356.20 |
| IUPAC Name | ethyl N-[6-[4-(4-methylpiperazin-1-yl)anilino]pyridazin-3-yl]carbamate |
| SMILES | CCOC(=O)Nc1ccc(Nc2ccc(N3CCN(C)CC3)cc2)nn1 |
| InChI | InChI=1S/C18H24N6O2/c1-3-26-18(25)20-17-9-8-16(21-22-17)19-14-4-6-15(7-5-14)24-12-10-23(2)11-13-24/h4-9H,3,10-13H2,1-2H3,(H,19,21)(H,20,22,25) |
| InChIKey | XDAQENFHFLNNGE-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 82.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.43 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|