C24H26N6O3 — CID 71223935
ethyl 2-[4-(4-methylpiperazin-1-yl)anilino]-4-(pyridine-4-carbonyl)pyrimidine-5-carboxylate (PubChem CID 71223935) has the molecular formula C24H26N6O3 and a molecular weight of 446.51 g/mol. Its IUPAC name is ethyl 2-[4-(4-methylpiperazin-1-yl)anilino]-4-(pyridine-4-carbonyl)pyrimidine-5-carboxylate.
| Compound Name | ethyl 2-[4-(4-methylpiperazin-1-yl)anilino]-4-(pyridine-4-carbonyl)pyrimidine-5-carboxylate |
|---|---|
| PubChem CID | 71223935 |
| Molecular Formula | C24H26N6O3 |
| Molecular Weight | 446.51 g/mol |
| Exact Mass | 446.21 |
| IUPAC Name | ethyl 2-[4-(4-methylpiperazin-1-yl)anilino]-4-(pyridine-4-carbonyl)pyrimidine-5-carboxylate |
| SMILES | CCOC(=O)c1cnc(Nc2ccc(N3CCN(C)CC3)cc2)nc1C(=O)c1ccncc1 |
| InChI | InChI=1S/C24H26N6O3/c1-3-33-23(32)20-16-26-24(28-21(20)22(31)17-8-10-25-11-9-17)27-18-4-6-19(7-5-18)30-14-12-29(2)13-15-30/h4-11,16H,3,12-15H2,1-2H3,(H,26,27,28) |
| InChIKey | SHSLPVYZYIZLDA-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 100.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.51 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|