C29H38N6O4S — CID 157421049
ethyl 4-[[3-(tert-butylsulfamoyl)phenyl]methyl]-2-[4-(4-methylpiperazin-1-yl)anilino]pyrimidine-5-carboxylate (PubChem CID 157421049) has the molecular formula C29H38N6O4S and a molecular weight of 566.73 g/mol. Its IUPAC name is ethyl 4-[[3-(tert-butylsulfamoyl)phenyl]methyl]-2-[4-(4-methylpiperazin-1-yl)anilino]pyrimidine-5-carboxylate.
| Compound Name | ethyl 4-[[3-(tert-butylsulfamoyl)phenyl]methyl]-2-[4-(4-methylpiperazin-1-yl)anilino]pyrimidine-5-carboxylate |
|---|---|
| PubChem CID | 157421049 |
| Molecular Formula | C29H38N6O4S |
| Molecular Weight | 566.73 g/mol |
| Exact Mass | 566.27 |
| IUPAC Name | ethyl 4-[[3-(tert-butylsulfamoyl)phenyl]methyl]-2-[4-(4-methylpiperazin-1-yl)anilino]pyrimidine-5-carboxylate |
| SMILES | CCOC(=O)c1cnc(Nc2ccc(N3CCN(C)CC3)cc2)nc1Cc1cccc(S(=O)(=O)NC(C)(C)C)c1 |
| InChI | InChI=1S/C29H38N6O4S/c1-6-39-27(36)25-20-30-28(31-22-10-12-23(13-11-22)35-16-14-34(5)15-17-35)32-26(25)19-21-8-7-9-24(18-21)40(37,38)33-29(2,3)4/h7-13,18,20,33H,6,14-17,19H2,1-5H3,(H,30,31,32) |
| InChIKey | BPKHNMVLPRNLMW-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 116.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.73 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|