C27H34FN5O2S — CID 147049815
4-[[3-(tert-butylsulfonylmethyl)phenyl]methyl]-5-fluoro-N-[4-(4-methylpiperazin-1-yl)phenyl]pyrimidin-2-amine (PubChem CID 147049815) has the molecular formula C27H34FN5O2S and a molecular weight of 511.67 g/mol. Its IUPAC name is 4-[[3-(tert-butylsulfonylmethyl)phenyl]methyl]-5-fluoro-N-[4-(4-methylpiperazin-1-yl)phenyl]pyrimidin-2-amine.
| Compound Name | 4-[[3-(tert-butylsulfonylmethyl)phenyl]methyl]-5-fluoro-N-[4-(4-methylpiperazin-1-yl)phenyl]pyrimidin-2-amine |
|---|---|
| PubChem CID | 147049815 |
| Molecular Formula | C27H34FN5O2S |
| Molecular Weight | 511.67 g/mol |
| Exact Mass | 511.24 |
| IUPAC Name | 4-[[3-(tert-butylsulfonylmethyl)phenyl]methyl]-5-fluoro-N-[4-(4-methylpiperazin-1-yl)phenyl]pyrimidin-2-amine |
| SMILES | CN1CCN(c2ccc(Nc3ncc(F)c(Cc4cccc(CS(=O)(=O)C(C)(C)C)c4)n3)cc2)CC1 |
| InChI | InChI=1S/C27H34FN5O2S/c1-27(2,3)36(34,35)19-21-7-5-6-20(16-21)17-25-24(28)18-29-26(31-25)30-22-8-10-23(11-9-22)33-14-12-32(4)13-15-33/h5-11,16,18H,12-15,17,19H2,1-4H3,(H,29,30,31) |
| InChIKey | BBBQNAXNLZUUQF-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.67 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|