C24H31FN8O2S — CID 67094000
4-N-[3-[(ethylsulfamoylamino)methyl]phenyl]-5-fluoro-2-N-[4-(4-methylpiperazin-1-yl)phenyl]pyrimidine-2,4-diamine (PubChem CID 67094000) has the molecular formula C24H31FN8O2S and a molecular weight of 514.63 g/mol. Its IUPAC name is 4-N-[3-[(ethylsulfamoylamino)methyl]phenyl]-5-fluoro-2-N-[4-(4-methylpiperazin-1-yl)phenyl]pyrimidine-2,4-diamine.
| Compound Name | 4-N-[3-[(ethylsulfamoylamino)methyl]phenyl]-5-fluoro-2-N-[4-(4-methylpiperazin-1-yl)phenyl]pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 67094000 |
| Molecular Formula | C24H31FN8O2S |
| Molecular Weight | 514.63 g/mol |
| Exact Mass | 514.23 |
| IUPAC Name | 4-N-[3-[(ethylsulfamoylamino)methyl]phenyl]-5-fluoro-2-N-[4-(4-methylpiperazin-1-yl)phenyl]pyrimidine-2,4-diamine |
| SMILES | CCNS(=O)(=O)NCc1cccc(Nc2nc(Nc3ccc(N4CCN(C)CC4)cc3)ncc2F)c1 |
| InChI | InChI=1S/C24H31FN8O2S/c1-3-27-36(34,35)28-16-18-5-4-6-20(15-18)29-23-22(25)17-26-24(31-23)30-19-7-9-21(10-8-19)33-13-11-32(2)12-14-33/h4-10,15,17,27-28H,3,11-14,16H2,1-2H3,(H2,26,29,30,31) |
| InChIKey | CWOHUNWBTLODSF-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 114.52 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.63 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|