C23H25ClFN7O — CID 144952643
N-[3-[[[5-chloro-2-[3-fluoro-4-(4-methylpiperazin-1-yl)anilino]pyrimidin-4-yl]amino]methyl]phenyl]formamide (PubChem CID 144952643) has the molecular formula C23H25ClFN7O and a molecular weight of 469.95 g/mol. Its IUPAC name is N-[3-[[[5-chloro-2-[3-fluoro-4-(4-methylpiperazin-1-yl)anilino]pyrimidin-4-yl]amino]methyl]phenyl]formamide.
| Compound Name | N-[3-[[[5-chloro-2-[3-fluoro-4-(4-methylpiperazin-1-yl)anilino]pyrimidin-4-yl]amino]methyl]phenyl]formamide |
|---|---|
| PubChem CID | 144952643 |
| Molecular Formula | C23H25ClFN7O |
| Molecular Weight | 469.95 g/mol |
| Exact Mass | 469.18 |
| IUPAC Name | N-[3-[[[5-chloro-2-[3-fluoro-4-(4-methylpiperazin-1-yl)anilino]pyrimidin-4-yl]amino]methyl]phenyl]formamide |
| SMILES | CN1CCN(c2ccc(Nc3ncc(Cl)c(NCc4cccc(NC=O)c4)n3)cc2F)CC1 |
| InChI | InChI=1S/C23H25ClFN7O/c1-31-7-9-32(10-8-31)21-6-5-18(12-20(21)25)29-23-27-14-19(24)22(30-23)26-13-16-3-2-4-17(11-16)28-15-33/h2-6,11-12,14-15H,7-10,13H2,1H3,(H,28,33)(H2,26,27,29,30) |
| InChIKey | MGVRJUZMPUOZCY-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 85.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.95 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|