C26H28ClN5O — CID 159180199
1-[3-[[[5-chloro-2-(4-piperidin-1-ylanilino)pyrimidin-4-yl]amino]methyl]phenyl]but-3-en-2-one (PubChem CID 159180199) has the molecular formula C26H28ClN5O and a molecular weight of 462.00 g/mol. Its IUPAC name is 1-[3-[[[5-chloro-2-(4-piperidin-1-ylanilino)pyrimidin-4-yl]amino]methyl]phenyl]but-3-en-2-one.
| Compound Name | 1-[3-[[[5-chloro-2-(4-piperidin-1-ylanilino)pyrimidin-4-yl]amino]methyl]phenyl]but-3-en-2-one |
|---|---|
| PubChem CID | 159180199 |
| Molecular Formula | C26H28ClN5O |
| Molecular Weight | 462.00 g/mol |
| Exact Mass | 461.20 |
| IUPAC Name | 1-[3-[[[5-chloro-2-(4-piperidin-1-ylanilino)pyrimidin-4-yl]amino]methyl]phenyl]but-3-en-2-one |
| SMILES | C=CC(=O)Cc1cccc(CNc2nc(Nc3ccc(N4CCCCC4)cc3)ncc2Cl)c1 |
| InChI | InChI=1S/C26H28ClN5O/c1-2-23(33)16-19-7-6-8-20(15-19)17-28-25-24(27)18-29-26(31-25)30-21-9-11-22(12-10-21)32-13-4-3-5-14-32/h2,6-12,15,18H,1,3-5,13-14,16-17H2,(H2,28,29,30,31) |
| InChIKey | RUANITMMLQPKAY-UHFFFAOYSA-N |
| XLogP | 5.77 |
| TPSA | 70.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.00 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|