C25H27ClN6O — CID 167676739
1-[2-[[5-chloro-2-[4-(4-methylpiperazin-1-yl)anilino]pyrimidin-4-yl]amino]phenyl]but-3-en-2-one (PubChem CID 167676739) has the molecular formula C25H27ClN6O and a molecular weight of 462.99 g/mol. Its IUPAC name is 1-[2-[[5-chloro-2-[4-(4-methylpiperazin-1-yl)anilino]pyrimidin-4-yl]amino]phenyl]but-3-en-2-one.
| Compound Name | 1-[2-[[5-chloro-2-[4-(4-methylpiperazin-1-yl)anilino]pyrimidin-4-yl]amino]phenyl]but-3-en-2-one |
|---|---|
| PubChem CID | 167676739 |
| Molecular Formula | C25H27ClN6O |
| Molecular Weight | 462.99 g/mol |
| Exact Mass | 462.19 |
| IUPAC Name | 1-[2-[[5-chloro-2-[4-(4-methylpiperazin-1-yl)anilino]pyrimidin-4-yl]amino]phenyl]but-3-en-2-one |
| SMILES | C=CC(=O)Cc1ccccc1Nc1nc(Nc2ccc(N3CCN(C)CC3)cc2)ncc1Cl |
| InChI | InChI=1S/C25H27ClN6O/c1-3-21(33)16-18-6-4-5-7-23(18)29-24-22(26)17-27-25(30-24)28-19-8-10-20(11-9-19)32-14-12-31(2)13-15-32/h3-11,17H,1,12-16H2,2H3,(H2,27,28,29,30) |
| InChIKey | DQCYWTWQNRQFNO-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 73.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.99 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|