C38H38N6O3 — CID 167597220
1-[2-[[2-[4-(4-methylpiperazin-1-yl)anilino]-5-[(4-phenoxyphenyl)methoxy]pyrimidin-4-yl]amino]phenyl]but-3-en-2-one (PubChem CID 167597220) has the molecular formula C38H38N6O3 and a molecular weight of 626.76 g/mol. Its IUPAC name is 1-[2-[[2-[4-(4-methylpiperazin-1-yl)anilino]-5-[(4-phenoxyphenyl)methoxy]pyrimidin-4-yl]amino]phenyl]but-3-en-2-one.
| Compound Name | 1-[2-[[2-[4-(4-methylpiperazin-1-yl)anilino]-5-[(4-phenoxyphenyl)methoxy]pyrimidin-4-yl]amino]phenyl]but-3-en-2-one |
|---|---|
| PubChem CID | 167597220 |
| Molecular Formula | C38H38N6O3 |
| Molecular Weight | 626.76 g/mol |
| Exact Mass | 626.30 |
| IUPAC Name | 1-[2-[[2-[4-(4-methylpiperazin-1-yl)anilino]-5-[(4-phenoxyphenyl)methoxy]pyrimidin-4-yl]amino]phenyl]but-3-en-2-one |
| SMILES | C=CC(=O)Cc1ccccc1Nc1nc(Nc2ccc(N3CCN(C)CC3)cc2)ncc1OCc1ccc(Oc2ccccc2)cc1 |
| InChI | InChI=1S/C38H38N6O3/c1-3-32(45)25-29-9-7-8-12-35(29)41-37-36(46-27-28-13-19-34(20-14-28)47-33-10-5-4-6-11-33)26-39-38(42-37)40-30-15-17-31(18-16-30)44-23-21-43(2)22-24-44/h3-20,26H,1,21-25,27H2,2H3,(H2,39,40,41,42) |
| InChIKey | JFWXHKLSZTZMEP-UHFFFAOYSA-N |
| XLogP | 7.38 |
| TPSA | 91.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 626.76 |
| LogP ≤ 5 | 7.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|