C21H23ClN8O — CID 44526828
3-[[5-chloro-2-[4-(4-methylpiperazin-1-yl)anilino]pyrimidin-4-yl]amino]pyridine-2-carboxamide (PubChem CID 44526828) has the molecular formula C21H23ClN8O and a molecular weight of 438.92 g/mol. Its IUPAC name is 3-[[5-chloro-2-[4-(4-methylpiperazin-1-yl)anilino]pyrimidin-4-yl]amino]pyridine-2-carboxamide.
| Compound Name | 3-[[5-chloro-2-[4-(4-methylpiperazin-1-yl)anilino]pyrimidin-4-yl]amino]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 44526828 |
| Molecular Formula | C21H23ClN8O |
| Molecular Weight | 438.92 g/mol |
| Exact Mass | 438.17 |
| IUPAC Name | 3-[[5-chloro-2-[4-(4-methylpiperazin-1-yl)anilino]pyrimidin-4-yl]amino]pyridine-2-carboxamide |
| SMILES | CN1CCN(c2ccc(Nc3ncc(Cl)c(Nc4cccnc4C(N)=O)n3)cc2)CC1 |
| InChI | InChI=1S/C21H23ClN8O/c1-29-9-11-30(12-10-29)15-6-4-14(5-7-15)26-21-25-13-16(22)20(28-21)27-17-3-2-8-24-18(17)19(23)31/h2-8,13H,9-12H2,1H3,(H2,23,31)(H2,25,26,27,28) |
| InChIKey | XIZHCULZNXZKNY-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 112.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.92 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|