C29H31N7O — CID 155432556
1-[4-[4-(2-aminoanilino)-2-[4-(4-methylpiperazin-1-yl)anilino]pyrimidin-5-yl]phenyl]ethanone (PubChem CID 155432556) has the molecular formula C29H31N7O and a molecular weight of 493.62 g/mol. Its IUPAC name is 1-[4-[4-(2-aminoanilino)-2-[4-(4-methylpiperazin-1-yl)anilino]pyrimidin-5-yl]phenyl]ethanone.
| Compound Name | 1-[4-[4-(2-aminoanilino)-2-[4-(4-methylpiperazin-1-yl)anilino]pyrimidin-5-yl]phenyl]ethanone |
|---|---|
| PubChem CID | 155432556 |
| Molecular Formula | C29H31N7O |
| Molecular Weight | 493.62 g/mol |
| Exact Mass | 493.26 |
| IUPAC Name | 1-[4-[4-(2-aminoanilino)-2-[4-(4-methylpiperazin-1-yl)anilino]pyrimidin-5-yl]phenyl]ethanone |
| SMILES | CC(=O)c1ccc(-c2cnc(Nc3ccc(N4CCN(C)CC4)cc3)nc2Nc2ccccc2N)cc1 |
| InChI | InChI=1S/C29H31N7O/c1-20(37)21-7-9-22(10-8-21)25-19-31-29(34-28(25)33-27-6-4-3-5-26(27)30)32-23-11-13-24(14-12-23)36-17-15-35(2)16-18-36/h3-14,19H,15-18,30H2,1-2H3,(H2,31,32,33,34) |
| InChIKey | YXUHUIWASPOTEY-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 99.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.62 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|