C22H24FN7O2 — CID 163214030
4-[[5-fluoro-2-[4-(4-methylpiperazin-1-yl)anilino]pyrimidin-4-yl]amino]-N-hydroxybenzamide (PubChem CID 163214030) has the molecular formula C22H24FN7O2 and a molecular weight of 437.48 g/mol. Its IUPAC name is 4-[[5-fluoro-2-[4-(4-methylpiperazin-1-yl)anilino]pyrimidin-4-yl]amino]-N-hydroxybenzamide.
| Compound Name | 4-[[5-fluoro-2-[4-(4-methylpiperazin-1-yl)anilino]pyrimidin-4-yl]amino]-N-hydroxybenzamide |
|---|---|
| PubChem CID | 163214030 |
| Molecular Formula | C22H24FN7O2 |
| Molecular Weight | 437.48 g/mol |
| Exact Mass | 437.20 |
| IUPAC Name | 4-[[5-fluoro-2-[4-(4-methylpiperazin-1-yl)anilino]pyrimidin-4-yl]amino]-N-hydroxybenzamide |
| SMILES | CN1CCN(c2ccc(Nc3ncc(F)c(Nc4ccc(C(=O)NO)cc4)n3)cc2)CC1 |
| InChI | InChI=1S/C22H24FN7O2/c1-29-10-12-30(13-11-29)18-8-6-17(7-9-18)26-22-24-14-19(23)20(27-22)25-16-4-2-15(3-5-16)21(31)28-32/h2-9,14,32H,10-13H2,1H3,(H,28,31)(H2,24,25,26,27) |
| InChIKey | QBCVBRLKQZPHJV-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 105.65 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.48 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|