C18H20FN7 — CID 134383489
5-fluoro-4-imidazol-1-yl-N-[4-(4-methylpiperazin-1-yl)phenyl]pyrimidin-2-amine (PubChem CID 134383489) has the molecular formula C18H20FN7 and a molecular weight of 353.41 g/mol. Its IUPAC name is 5-fluoro-4-imidazol-1-yl-N-[4-(4-methylpiperazin-1-yl)phenyl]pyrimidin-2-amine.
| Compound Name | 5-fluoro-4-imidazol-1-yl-N-[4-(4-methylpiperazin-1-yl)phenyl]pyrimidin-2-amine |
|---|---|
| PubChem CID | 134383489 |
| Molecular Formula | C18H20FN7 |
| Molecular Weight | 353.41 g/mol |
| Exact Mass | 353.18 |
| IUPAC Name | 5-fluoro-4-imidazol-1-yl-N-[4-(4-methylpiperazin-1-yl)phenyl]pyrimidin-2-amine |
| SMILES | CN1CCN(c2ccc(Nc3ncc(F)c(-n4ccnc4)n3)cc2)CC1 |
| InChI | InChI=1S/C18H20FN7/c1-24-8-10-25(11-9-24)15-4-2-14(3-5-15)22-18-21-12-16(19)17(23-18)26-7-6-20-13-26/h2-7,12-13H,8-11H2,1H3,(H,21,22,23) |
| InChIKey | YDHGVIGSFIBLAF-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 62.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.41 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|