C24H24F3N7 — CID 169085545
4-(1-methylbenzimidazol-5-yl)-N-[4-(4-methylpiperazin-1-yl)phenyl]-5-(trifluoromethyl)pyrimidin-2-amine (PubChem CID 169085545) has the molecular formula C24H24F3N7 and a molecular weight of 467.50 g/mol. Its IUPAC name is 4-(1-methylbenzimidazol-5-yl)-N-[4-(4-methylpiperazin-1-yl)phenyl]-5-(trifluoromethyl)pyrimidin-2-amine.
| Compound Name | 4-(1-methylbenzimidazol-5-yl)-N-[4-(4-methylpiperazin-1-yl)phenyl]-5-(trifluoromethyl)pyrimidin-2-amine |
|---|---|
| PubChem CID | 169085545 |
| Molecular Formula | C24H24F3N7 |
| Molecular Weight | 467.50 g/mol |
| Exact Mass | 467.20 |
| IUPAC Name | 4-(1-methylbenzimidazol-5-yl)-N-[4-(4-methylpiperazin-1-yl)phenyl]-5-(trifluoromethyl)pyrimidin-2-amine |
| SMILES | CN1CCN(c2ccc(Nc3ncc(C(F)(F)F)c(-c4ccc5c(c4)ncn5C)n3)cc2)CC1 |
| InChI | InChI=1S/C24H24F3N7/c1-32-9-11-34(12-10-32)18-6-4-17(5-7-18)30-23-28-14-19(24(25,26)27)22(31-23)16-3-8-21-20(13-16)29-15-33(21)2/h3-8,13-15H,9-12H2,1-2H3,(H,28,30,31) |
| InChIKey | DQXMMUJBDAXQCU-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 62.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.50 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|