C26H33N7 — CID 142742906
N-[4-(4-methylpiperazin-1-yl)phenyl]-8-piperidin-1-yl-5,6-dihydropyrimido[5,4-g]indolizin-2-amine (PubChem CID 142742906) has the molecular formula C26H33N7 and a molecular weight of 443.60 g/mol. Its IUPAC name is N-[4-(4-methylpiperazin-1-yl)phenyl]-8-piperidin-1-yl-5,6-dihydropyrimido[5,4-g]indolizin-2-amine.
| Compound Name | N-[4-(4-methylpiperazin-1-yl)phenyl]-8-piperidin-1-yl-5,6-dihydropyrimido[5,4-g]indolizin-2-amine |
|---|---|
| PubChem CID | 142742906 |
| Molecular Formula | C26H33N7 |
| Molecular Weight | 443.60 g/mol |
| Exact Mass | 443.28 |
| IUPAC Name | N-[4-(4-methylpiperazin-1-yl)phenyl]-8-piperidin-1-yl-5,6-dihydropyrimido[5,4-g]indolizin-2-amine |
| SMILES | CN1CCN(c2ccc(Nc3ncc4c(n3)-c3ccc(N5CCCCC5)n3CC4)cc2)CC1 |
| InChI | InChI=1S/C26H33N7/c1-30-15-17-31(18-16-30)22-7-5-21(6-8-22)28-26-27-19-20-11-14-33-23(25(20)29-26)9-10-24(33)32-12-3-2-4-13-32/h5-10,19H,2-4,11-18H2,1H3,(H,27,28,29) |
| InChIKey | IKIJKWHKSMAWIK-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 52.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.60 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|