C17H30N6P4 — CID 157145988
4-N,5-dimethyl-2-N-[4-(4-methylpiperazin-1-yl)phenyl]pyrimidine-2,4-diamine;tris(phosphanyl)phosphane (PubChem CID 157145988) has the molecular formula C17H30N6P4 and a molecular weight of 442.37 g/mol. Its IUPAC name is 4-N,5-dimethyl-2-N-[4-(4-methylpiperazin-1-yl)phenyl]pyrimidine-2,4-diamine;tris(phosphanyl)phosphane.
| Compound Name | 4-N,5-dimethyl-2-N-[4-(4-methylpiperazin-1-yl)phenyl]pyrimidine-2,4-diamine;tris(phosphanyl)phosphane |
|---|---|
| PubChem CID | 157145988 |
| Molecular Formula | C17H30N6P4 |
| Molecular Weight | 442.37 g/mol |
| Exact Mass | 442.15 |
| IUPAC Name | 4-N,5-dimethyl-2-N-[4-(4-methylpiperazin-1-yl)phenyl]pyrimidine-2,4-diamine;tris(phosphanyl)phosphane |
| SMILES | CNc1nc(Nc2ccc(N3CCN(C)CC3)cc2)ncc1C.PP(P)P |
| InChI | InChI=1S/C17H24N6.H6P4/c1-13-12-19-17(21-16(13)18-2)20-14-4-6-15(7-5-14)23-10-8-22(3)9-11-23;1-4(2)3/h4-7,12H,8-11H2,1-3H3,(H2,18,19,20,21);1-3H2 |
| InChIKey | AKSBAFNJUYTFHU-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 56.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.37 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|