C16H19N7 — CID 68702089
N-[4-(4-methylpiperazin-1-yl)phenyl]-1H-pyrazolo[3,4-d]pyrimidin-6-amine (PubChem CID 68702089) has the molecular formula C16H19N7 and a molecular weight of 309.38 g/mol. Its IUPAC name is N-[4-(4-methylpiperazin-1-yl)phenyl]-1H-pyrazolo[3,4-d]pyrimidin-6-amine.
| Compound Name | N-[4-(4-methylpiperazin-1-yl)phenyl]-1H-pyrazolo[3,4-d]pyrimidin-6-amine |
|---|---|
| PubChem CID | 68702089 |
| Molecular Formula | C16H19N7 |
| Molecular Weight | 309.38 g/mol |
| Exact Mass | 309.17 |
| IUPAC Name | N-[4-(4-methylpiperazin-1-yl)phenyl]-1H-pyrazolo[3,4-d]pyrimidin-6-amine |
| SMILES | CN1CCN(c2ccc(Nc3ncc4cn[nH]c4n3)cc2)CC1 |
| InChI | InChI=1S/C16H19N7/c1-22-6-8-23(9-7-22)14-4-2-13(3-5-14)19-16-17-10-12-11-18-21-15(12)20-16/h2-5,10-11H,6-9H2,1H3,(H2,17,18,19,20,21) |
| InChIKey | KIFYBRXQVPEBPY-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 72.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.38 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|