C24H25N7 — CID 141081134
N-[4-(4-methylpiperazin-1-yl)phenyl]-4-(5-phenyl-1H-pyrazol-4-yl)pyrimidin-2-amine (PubChem CID 141081134) has the molecular formula C24H25N7 and a molecular weight of 411.51 g/mol. Its IUPAC name is N-[4-(4-methylpiperazin-1-yl)phenyl]-4-(5-phenyl-1H-pyrazol-4-yl)pyrimidin-2-amine.
| Compound Name | N-[4-(4-methylpiperazin-1-yl)phenyl]-4-(5-phenyl-1H-pyrazol-4-yl)pyrimidin-2-amine |
|---|---|
| PubChem CID | 141081134 |
| Molecular Formula | C24H25N7 |
| Molecular Weight | 411.51 g/mol |
| Exact Mass | 411.22 |
| IUPAC Name | N-[4-(4-methylpiperazin-1-yl)phenyl]-4-(5-phenyl-1H-pyrazol-4-yl)pyrimidin-2-amine |
| SMILES | CN1CCN(c2ccc(Nc3nccc(-c4cn[nH]c4-c4ccccc4)n3)cc2)CC1 |
| InChI | InChI=1S/C24H25N7/c1-30-13-15-31(16-14-30)20-9-7-19(8-10-20)27-24-25-12-11-22(28-24)21-17-26-29-23(21)18-5-3-2-4-6-18/h2-12,17H,13-16H2,1H3,(H,26,29)(H,25,27,28) |
| InChIKey | PHVMGFZBCQXPQL-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 72.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.51 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|