C25H27N7 — CID 141081137
4-[5-(4-methylphenyl)-1H-pyrazol-4-yl]-N-[4-(piperazin-1-ylmethyl)phenyl]pyrimidin-2-amine (PubChem CID 141081137) has the molecular formula C25H27N7 and a molecular weight of 425.54 g/mol. Its IUPAC name is 4-[5-(4-methylphenyl)-1H-pyrazol-4-yl]-N-[4-(piperazin-1-ylmethyl)phenyl]pyrimidin-2-amine.
| Compound Name | 4-[5-(4-methylphenyl)-1H-pyrazol-4-yl]-N-[4-(piperazin-1-ylmethyl)phenyl]pyrimidin-2-amine |
|---|---|
| PubChem CID | 141081137 |
| Molecular Formula | C25H27N7 |
| Molecular Weight | 425.54 g/mol |
| Exact Mass | 425.23 |
| IUPAC Name | 4-[5-(4-methylphenyl)-1H-pyrazol-4-yl]-N-[4-(piperazin-1-ylmethyl)phenyl]pyrimidin-2-amine |
| SMILES | Cc1ccc(-c2[nH]ncc2-c2ccnc(Nc3ccc(CN4CCNCC4)cc3)n2)cc1 |
| InChI | InChI=1S/C25H27N7/c1-18-2-6-20(7-3-18)24-22(16-28-31-24)23-10-11-27-25(30-23)29-21-8-4-19(5-9-21)17-32-14-12-26-13-15-32/h2-11,16,26H,12-15,17H2,1H3,(H,28,31)(H,27,29,30) |
| InChIKey | JPXMYNIVVIIETK-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 81.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.54 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |