C24H24ClN7 — CID 10456191
4-[5-(4-chlorophenyl)-1H-pyrazol-4-yl]-N-[4-(4-methylpiperazin-1-yl)phenyl]pyrimidin-2-amine (PubChem CID 10456191) has the molecular formula C24H24ClN7 and a molecular weight of 445.96 g/mol. Its IUPAC name is 4-[5-(4-chlorophenyl)-1H-pyrazol-4-yl]-N-[4-(4-methylpiperazin-1-yl)phenyl]pyrimidin-2-amine.
| Compound Name | 4-[5-(4-chlorophenyl)-1H-pyrazol-4-yl]-N-[4-(4-methylpiperazin-1-yl)phenyl]pyrimidin-2-amine |
|---|---|
| PubChem CID | 10456191 |
| Molecular Formula | C24H24ClN7 |
| Molecular Weight | 445.96 g/mol |
| Exact Mass | 445.18 |
| IUPAC Name | 4-[5-(4-chlorophenyl)-1H-pyrazol-4-yl]-N-[4-(4-methylpiperazin-1-yl)phenyl]pyrimidin-2-amine |
| SMILES | CN1CCN(c2ccc(Nc3nccc(-c4cn[nH]c4-c4ccc(Cl)cc4)n3)cc2)CC1 |
| InChI | InChI=1S/C24H24ClN7/c1-31-12-14-32(15-13-31)20-8-6-19(7-9-20)28-24-26-11-10-22(29-24)21-16-27-30-23(21)17-2-4-18(25)5-3-17/h2-11,16H,12-15H2,1H3,(H,27,30)(H,26,28,29) |
| InChIKey | GICWHMKTHBWAGE-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 72.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.96 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|