C22H21ClF3N5 — CID 164836748
4-(4-chlorophenyl)-N-[4-(4-methylpiperazin-1-yl)-3-(trifluoromethyl)phenyl]pyrimidin-2-amine (PubChem CID 164836748) has the molecular formula C22H21ClF3N5 and a molecular weight of 447.89 g/mol. Its IUPAC name is 4-(4-chlorophenyl)-N-[4-(4-methylpiperazin-1-yl)-3-(trifluoromethyl)phenyl]pyrimidin-2-amine.
| Compound Name | 4-(4-chlorophenyl)-N-[4-(4-methylpiperazin-1-yl)-3-(trifluoromethyl)phenyl]pyrimidin-2-amine |
|---|---|
| PubChem CID | 164836748 |
| Molecular Formula | C22H21ClF3N5 |
| Molecular Weight | 447.89 g/mol |
| Exact Mass | 447.14 |
| IUPAC Name | 4-(4-chlorophenyl)-N-[4-(4-methylpiperazin-1-yl)-3-(trifluoromethyl)phenyl]pyrimidin-2-amine |
| SMILES | CN1CCN(c2ccc(Nc3nccc(-c4ccc(Cl)cc4)n3)cc2C(F)(F)F)CC1 |
| InChI | InChI=1S/C22H21ClF3N5/c1-30-10-12-31(13-11-30)20-7-6-17(14-18(20)22(24,25)26)28-21-27-9-8-19(29-21)15-2-4-16(23)5-3-15/h2-9,14H,10-13H2,1H3,(H,27,28,29) |
| InChIKey | DODADZMFXZGOMF-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 44.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.89 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|