C29H27F3N6O — CID 11341590
4-methyl-N-[4-piperidin-1-yl-3-(trifluoromethyl)phenyl]-3-[(4-pyridin-3-ylpyrimidin-2-yl)amino]benzamide (PubChem CID 11341590) has the molecular formula C29H27F3N6O and a molecular weight of 532.57 g/mol. Its IUPAC name is 4-methyl-N-[4-piperidin-1-yl-3-(trifluoromethyl)phenyl]-3-[(4-pyridin-3-ylpyrimidin-2-yl)amino]benzamide.
| Compound Name | 4-methyl-N-[4-piperidin-1-yl-3-(trifluoromethyl)phenyl]-3-[(4-pyridin-3-ylpyrimidin-2-yl)amino]benzamide |
|---|---|
| PubChem CID | 11341590 |
| Molecular Formula | C29H27F3N6O |
| Molecular Weight | 532.57 g/mol |
| Exact Mass | 532.22 |
| IUPAC Name | 4-methyl-N-[4-piperidin-1-yl-3-(trifluoromethyl)phenyl]-3-[(4-pyridin-3-ylpyrimidin-2-yl)amino]benzamide |
| SMILES | Cc1ccc(C(=O)Nc2ccc(N3CCCCC3)c(C(F)(F)F)c2)cc1Nc1nccc(-c2cccnc2)n1 |
| InChI | InChI=1S/C29H27F3N6O/c1-19-7-8-20(16-25(19)37-28-34-13-11-24(36-28)21-6-5-12-33-18-21)27(39)35-22-9-10-26(23(17-22)29(30,31)32)38-14-3-2-4-15-38/h5-13,16-18H,2-4,14-15H2,1H3,(H,35,39)(H,34,36,37) |
| InChIKey | PPDDEWSNLUAWJJ-UHFFFAOYSA-N |
| XLogP | 6.85 |
| TPSA | 83.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.57 |
| LogP ≤ 5 | 6.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|