C28H23F3N6O2 — CID 25126229
4-methyl-N-[4-[(prop-2-enoylamino)methyl]-3-(trifluoromethyl)phenyl]-3-[(4-pyridin-3-ylpyrimidin-2-yl)amino]benzamide (PubChem CID 25126229) has the molecular formula C28H23F3N6O2 and a molecular weight of 532.53 g/mol. Its IUPAC name is 4-methyl-N-[4-[(prop-2-enoylamino)methyl]-3-(trifluoromethyl)phenyl]-3-[(4-pyridin-3-ylpyrimidin-2-yl)amino]benzamide.
| Compound Name | 4-methyl-N-[4-[(prop-2-enoylamino)methyl]-3-(trifluoromethyl)phenyl]-3-[(4-pyridin-3-ylpyrimidin-2-yl)amino]benzamide |
|---|---|
| PubChem CID | 25126229 |
| Molecular Formula | C28H23F3N6O2 |
| Molecular Weight | 532.53 g/mol |
| Exact Mass | 532.18 |
| IUPAC Name | 4-methyl-N-[4-[(prop-2-enoylamino)methyl]-3-(trifluoromethyl)phenyl]-3-[(4-pyridin-3-ylpyrimidin-2-yl)amino]benzamide |
| SMILES | C=CC(=O)NCc1ccc(NC(=O)c2ccc(C)c(Nc3nccc(-c4cccnc4)n3)c2)cc1C(F)(F)F |
| InChI | InChI=1S/C28H23F3N6O2/c1-3-25(38)34-16-19-8-9-21(14-22(19)28(29,30)31)35-26(39)18-7-6-17(2)24(13-18)37-27-33-12-10-23(36-27)20-5-4-11-32-15-20/h3-15H,1,16H2,2H3,(H,34,38)(H,35,39)(H,33,36,37) |
| InChIKey | IIYOZMHKMATXCB-UHFFFAOYSA-N |
| XLogP | 5.66 |
| TPSA | 108.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.53 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|