C26H22N6O2 — CID 71664306
4-methyl-3-(prop-2-enoylamino)-N-[4-[(4-pyridin-3-ylpyrimidin-2-yl)amino]phenyl]benzamide (PubChem CID 71664306) has the molecular formula C26H22N6O2 and a molecular weight of 450.50 g/mol. Its IUPAC name is 4-methyl-3-(prop-2-enoylamino)-N-[4-[(4-pyridin-3-ylpyrimidin-2-yl)amino]phenyl]benzamide.
| Compound Name | 4-methyl-3-(prop-2-enoylamino)-N-[4-[(4-pyridin-3-ylpyrimidin-2-yl)amino]phenyl]benzamide |
|---|---|
| PubChem CID | 71664306 |
| Molecular Formula | C26H22N6O2 |
| Molecular Weight | 450.50 g/mol |
| Exact Mass | 450.18 |
| IUPAC Name | 4-methyl-3-(prop-2-enoylamino)-N-[4-[(4-pyridin-3-ylpyrimidin-2-yl)amino]phenyl]benzamide |
| SMILES | C=CC(=O)Nc1cc(C(=O)Nc2ccc(Nc3nccc(-c4cccnc4)n3)cc2)ccc1C |
| InChI | InChI=1S/C26H22N6O2/c1-3-24(33)31-23-15-18(7-6-17(23)2)25(34)29-20-8-10-21(11-9-20)30-26-28-14-12-22(32-26)19-5-4-13-27-16-19/h3-16H,1H2,2H3,(H,29,34)(H,31,33)(H,28,30,32) |
| InChIKey | BCSWZVANHWJRTI-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 108.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.50 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|