C25H26F3N7O — CID 57340661
5,11-dimethyl-2-[4-(4-methylpiperazin-1-yl)-3-(trifluoromethyl)anilino]pyrimido[4,5-b][1,4]benzodiazepin-6-one (PubChem CID 57340661) has the molecular formula C25H26F3N7O and a molecular weight of 497.53 g/mol. Its IUPAC name is 5,11-dimethyl-2-[4-(4-methylpiperazin-1-yl)-3-(trifluoromethyl)anilino]pyrimido[4,5-b][1,4]benzodiazepin-6-one.
| Compound Name | 5,11-dimethyl-2-[4-(4-methylpiperazin-1-yl)-3-(trifluoromethyl)anilino]pyrimido[4,5-b][1,4]benzodiazepin-6-one |
|---|---|
| PubChem CID | 57340661 |
| Molecular Formula | C25H26F3N7O |
| Molecular Weight | 497.53 g/mol |
| Exact Mass | 497.22 |
| IUPAC Name | 5,11-dimethyl-2-[4-(4-methylpiperazin-1-yl)-3-(trifluoromethyl)anilino]pyrimido[4,5-b][1,4]benzodiazepin-6-one |
| SMILES | CN1CCN(c2ccc(Nc3ncc4c(n3)N(C)c3ccccc3C(=O)N4C)cc2C(F)(F)F)CC1 |
| InChI | InChI=1S/C25H26F3N7O/c1-32-10-12-35(13-11-32)20-9-8-16(14-18(20)25(26,27)28)30-24-29-15-21-22(31-24)33(2)19-7-5-4-6-17(19)23(36)34(21)3/h4-9,14-15H,10-13H2,1-3H3,(H,29,30,31) |
| InChIKey | OTHOIVJRAHPREM-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 67.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.53 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|