C28H33N7O2 — CID 118684153
5,11-dimethyl-2-[4-(4-morpholin-4-ylpiperidin-1-yl)anilino]pyrimido[4,5-b][1,4]benzodiazepin-6-one (PubChem CID 118684153) has the molecular formula C28H33N7O2 and a molecular weight of 499.62 g/mol. Its IUPAC name is 5,11-dimethyl-2-[4-(4-morpholin-4-ylpiperidin-1-yl)anilino]pyrimido[4,5-b][1,4]benzodiazepin-6-one.
| Compound Name | 5,11-dimethyl-2-[4-(4-morpholin-4-ylpiperidin-1-yl)anilino]pyrimido[4,5-b][1,4]benzodiazepin-6-one |
|---|---|
| PubChem CID | 118684153 |
| Molecular Formula | C28H33N7O2 |
| Molecular Weight | 499.62 g/mol |
| Exact Mass | 499.27 |
| IUPAC Name | 5,11-dimethyl-2-[4-(4-morpholin-4-ylpiperidin-1-yl)anilino]pyrimido[4,5-b][1,4]benzodiazepin-6-one |
| SMILES | CN1C(=O)c2ccccc2N(C)c2nc(Nc3ccc(N4CCC(N5CCOCC5)CC4)cc3)ncc21 |
| InChI | InChI=1S/C28H33N7O2/c1-32-24-6-4-3-5-23(24)27(36)33(2)25-19-29-28(31-26(25)32)30-20-7-9-21(10-8-20)34-13-11-22(12-14-34)35-15-17-37-18-16-35/h3-10,19,22H,11-18H2,1-2H3,(H,29,30,31) |
| InChIKey | RCMMDXYFBGENBH-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 77.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.62 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|