C25H24N6O2 — CID 86267609
15-[4-(4-hydroxypiperidin-1-yl)anilino]-2-methyl-2,10,14,16-tetrazatetracyclo[8.6.1.03,8.013,17]heptadeca-1(16),3,5,7,11,13(17),14-heptaen-9-one (PubChem CID 86267609) has the molecular formula C25H24N6O2 and a molecular weight of 440.51 g/mol. Its IUPAC name is 15-[4-(4-hydroxypiperidin-1-yl)anilino]-2-methyl-2,10,14,16-tetrazatetracyclo[8.6.1.03,8.013,17]heptadeca-1(16),3,5,7,11,13(17),14-heptaen-9-one.
| Compound Name | 15-[4-(4-hydroxypiperidin-1-yl)anilino]-2-methyl-2,10,14,16-tetrazatetracyclo[8.6.1.03,8.013,17]heptadeca-1(16),3,5,7,11,13(17),14-heptaen-9-one |
|---|---|
| PubChem CID | 86267609 |
| Molecular Formula | C25H24N6O2 |
| Molecular Weight | 440.51 g/mol |
| Exact Mass | 440.20 |
| IUPAC Name | 15-[4-(4-hydroxypiperidin-1-yl)anilino]-2-methyl-2,10,14,16-tetrazatetracyclo[8.6.1.03,8.013,17]heptadeca-1(16),3,5,7,11,13(17),14-heptaen-9-one |
| SMILES | CN1c2ccccc2C(=O)n2ccc3nc(Nc4ccc(N5CCC(O)CC5)cc4)nc1c32 |
| InChI | InChI=1S/C25H24N6O2/c1-29-21-5-3-2-4-19(21)24(33)31-15-12-20-22(31)23(29)28-25(27-20)26-16-6-8-17(9-7-16)30-13-10-18(32)11-14-30/h2-9,12,15,18,32H,10-11,13-14H2,1H3,(H,26,27,28) |
| InChIKey | YHLLEGHEOKJUCO-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 86.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.51 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|