C26H30N6OS — CID 140936176
1-[4-[[4-(2-propan-2-ylsulfanylanilino)-5H-pyrrolo[3,2-d]pyrimidin-2-yl]amino]phenyl]piperidin-4-ol (PubChem CID 140936176) has the molecular formula C26H30N6OS and a molecular weight of 474.63 g/mol. Its IUPAC name is 1-[4-[[4-(2-propan-2-ylsulfanylanilino)-5H-pyrrolo[3,2-d]pyrimidin-2-yl]amino]phenyl]piperidin-4-ol.
| Compound Name | 1-[4-[[4-(2-propan-2-ylsulfanylanilino)-5H-pyrrolo[3,2-d]pyrimidin-2-yl]amino]phenyl]piperidin-4-ol |
|---|---|
| PubChem CID | 140936176 |
| Molecular Formula | C26H30N6OS |
| Molecular Weight | 474.63 g/mol |
| Exact Mass | 474.22 |
| IUPAC Name | 1-[4-[[4-(2-propan-2-ylsulfanylanilino)-5H-pyrrolo[3,2-d]pyrimidin-2-yl]amino]phenyl]piperidin-4-ol |
| SMILES | CC(C)Sc1ccccc1Nc1nc(Nc2ccc(N3CCC(O)CC3)cc2)nc2cc[nH]c12 |
| InChI | InChI=1S/C26H30N6OS/c1-17(2)34-23-6-4-3-5-21(23)29-25-24-22(11-14-27-24)30-26(31-25)28-18-7-9-19(10-8-18)32-15-12-20(33)13-16-32/h3-11,14,17,20,27,33H,12-13,15-16H2,1-2H3,(H2,28,29,30,31) |
| InChIKey | TXEOSCMQHTXLBD-UHFFFAOYSA-N |
| XLogP | 5.91 |
| TPSA | 89.10 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.63 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|