C27H32N6O3S — CID 140936149
1-[4-[[4-[(2-propan-2-ylsulfonylphenyl)methylamino]-5H-pyrrolo[3,2-d]pyrimidin-2-yl]amino]phenyl]piperidin-4-ol (PubChem CID 140936149) has the molecular formula C27H32N6O3S and a molecular weight of 520.66 g/mol. Its IUPAC name is 1-[4-[[4-[(2-propan-2-ylsulfonylphenyl)methylamino]-5H-pyrrolo[3,2-d]pyrimidin-2-yl]amino]phenyl]piperidin-4-ol.
| Compound Name | 1-[4-[[4-[(2-propan-2-ylsulfonylphenyl)methylamino]-5H-pyrrolo[3,2-d]pyrimidin-2-yl]amino]phenyl]piperidin-4-ol |
|---|---|
| PubChem CID | 140936149 |
| Molecular Formula | C27H32N6O3S |
| Molecular Weight | 520.66 g/mol |
| Exact Mass | 520.23 |
| IUPAC Name | 1-[4-[[4-[(2-propan-2-ylsulfonylphenyl)methylamino]-5H-pyrrolo[3,2-d]pyrimidin-2-yl]amino]phenyl]piperidin-4-ol |
| SMILES | CC(C)S(=O)(=O)c1ccccc1CNc1nc(Nc2ccc(N3CCC(O)CC3)cc2)nc2cc[nH]c12 |
| InChI | InChI=1S/C27H32N6O3S/c1-18(2)37(35,36)24-6-4-3-5-19(24)17-29-26-25-23(11-14-28-25)31-27(32-26)30-20-7-9-21(10-8-20)33-15-12-22(34)13-16-33/h3-11,14,18,22,28,34H,12-13,15-17H2,1-2H3,(H2,29,30,31,32) |
| InChIKey | XUXFCOKODWIFLC-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 123.24 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.66 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|