C25H27N5O3S2 — CID 134256328
2-N-(4-morpholin-4-ylphenyl)-4-N-(2-propan-2-ylsulfonylphenyl)thieno[3,2-d]pyrimidine-2,4-diamine (PubChem CID 134256328) has the molecular formula C25H27N5O3S2 and a molecular weight of 509.66 g/mol. Its IUPAC name is 2-N-(4-morpholin-4-ylphenyl)-4-N-(2-propan-2-ylsulfonylphenyl)thieno[3,2-d]pyrimidine-2,4-diamine.
| Compound Name | 2-N-(4-morpholin-4-ylphenyl)-4-N-(2-propan-2-ylsulfonylphenyl)thieno[3,2-d]pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 134256328 |
| Molecular Formula | C25H27N5O3S2 |
| Molecular Weight | 509.66 g/mol |
| Exact Mass | 509.16 |
| IUPAC Name | 2-N-(4-morpholin-4-ylphenyl)-4-N-(2-propan-2-ylsulfonylphenyl)thieno[3,2-d]pyrimidine-2,4-diamine |
| SMILES | CC(C)S(=O)(=O)c1ccccc1Nc1nc(Nc2ccc(N3CCOCC3)cc2)nc2ccsc12 |
| InChI | InChI=1S/C25H27N5O3S2/c1-17(2)35(31,32)22-6-4-3-5-20(22)27-24-23-21(11-16-34-23)28-25(29-24)26-18-7-9-19(10-8-18)30-12-14-33-15-13-30/h3-11,16-17H,12-15H2,1-2H3,(H2,26,27,28,29) |
| InChIKey | NWNGGFIARHQTRK-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 96.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.66 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|