C25H31ClN6O4S — CID 25225945
5-chloro-2-N-(2-ethoxy-4-morpholin-4-ylphenyl)-4-N-(2-propan-2-ylsulfonylphenyl)pyrimidine-2,4,6-triamine (PubChem CID 25225945) has the molecular formula C25H31ClN6O4S and a molecular weight of 547.08 g/mol. Its IUPAC name is 5-chloro-2-N-(2-ethoxy-4-morpholin-4-ylphenyl)-4-N-(2-propan-2-ylsulfonylphenyl)pyrimidine-2,4,6-triamine.
| Compound Name | 5-chloro-2-N-(2-ethoxy-4-morpholin-4-ylphenyl)-4-N-(2-propan-2-ylsulfonylphenyl)pyrimidine-2,4,6-triamine |
|---|---|
| PubChem CID | 25225945 |
| Molecular Formula | C25H31ClN6O4S |
| Molecular Weight | 547.08 g/mol |
| Exact Mass | 546.18 |
| IUPAC Name | 5-chloro-2-N-(2-ethoxy-4-morpholin-4-ylphenyl)-4-N-(2-propan-2-ylsulfonylphenyl)pyrimidine-2,4,6-triamine |
| SMILES | CCOc1cc(N2CCOCC2)ccc1Nc1nc(N)c(Cl)c(Nc2ccccc2S(=O)(=O)C(C)C)n1 |
| InChI | InChI=1S/C25H31ClN6O4S/c1-4-36-20-15-17(32-11-13-35-14-12-32)9-10-18(20)29-25-30-23(27)22(26)24(31-25)28-19-7-5-6-8-21(19)37(33,34)16(2)3/h5-10,15-16H,4,11-14H2,1-3H3,(H4,27,28,29,30,31) |
| InChIKey | XZRUESZLTXWFGD-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 131.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.08 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|