C27H33ClN6O4S — CID 59737689
1-[4-[[5-chloro-4-(2-propan-2-ylsulfonylanilino)pyrimidin-2-yl]amino]-3-ethoxyphenyl]piperidine-3-carboxamide (PubChem CID 59737689) has the molecular formula C27H33ClN6O4S and a molecular weight of 573.12 g/mol. Its IUPAC name is 1-[4-[[5-chloro-4-(2-propan-2-ylsulfonylanilino)pyrimidin-2-yl]amino]-3-ethoxyphenyl]piperidine-3-carboxamide.
| Compound Name | 1-[4-[[5-chloro-4-(2-propan-2-ylsulfonylanilino)pyrimidin-2-yl]amino]-3-ethoxyphenyl]piperidine-3-carboxamide |
|---|---|
| PubChem CID | 59737689 |
| Molecular Formula | C27H33ClN6O4S |
| Molecular Weight | 573.12 g/mol |
| Exact Mass | 572.20 |
| IUPAC Name | 1-[4-[[5-chloro-4-(2-propan-2-ylsulfonylanilino)pyrimidin-2-yl]amino]-3-ethoxyphenyl]piperidine-3-carboxamide |
| SMILES | CCOc1cc(N2CCCC(C(N)=O)C2)ccc1Nc1ncc(Cl)c(Nc2ccccc2S(=O)(=O)C(C)C)n1 |
| InChI | InChI=1S/C27H33ClN6O4S/c1-4-38-23-14-19(34-13-7-8-18(16-34)25(29)35)11-12-21(23)32-27-30-15-20(28)26(33-27)31-22-9-5-6-10-24(22)39(36,37)17(2)3/h5-6,9-12,14-15,17-18H,4,7-8,13,16H2,1-3H3,(H2,29,35)(H2,30,31,32,33) |
| InChIKey | VVHDLBAOCSGYEC-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 139.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.12 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|