C28H36ClN7O3 — CID 143003273
1-[4-[[5-chloro-4-[2-[ethylamino(methoxy)methyl]anilino]pyrimidin-2-yl]amino]-3-ethoxyphenyl]piperidine-4-carboxamide (PubChem CID 143003273) has the molecular formula C28H36ClN7O3 and a molecular weight of 554.10 g/mol. Its IUPAC name is 1-[4-[[5-chloro-4-[2-[ethylamino(methoxy)methyl]anilino]pyrimidin-2-yl]amino]-3-ethoxyphenyl]piperidine-4-carboxamide.
| Compound Name | 1-[4-[[5-chloro-4-[2-[ethylamino(methoxy)methyl]anilino]pyrimidin-2-yl]amino]-3-ethoxyphenyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 143003273 |
| Molecular Formula | C28H36ClN7O3 |
| Molecular Weight | 554.10 g/mol |
| Exact Mass | 553.26 |
| IUPAC Name | 1-[4-[[5-chloro-4-[2-[ethylamino(methoxy)methyl]anilino]pyrimidin-2-yl]amino]-3-ethoxyphenyl]piperidine-4-carboxamide |
| SMILES | CCNC(OC)c1ccccc1Nc1nc(Nc2ccc(N3CCC(C(N)=O)CC3)cc2OCC)ncc1Cl |
| InChI | InChI=1S/C28H36ClN7O3/c1-4-31-27(38-3)20-8-6-7-9-22(20)33-26-21(29)17-32-28(35-26)34-23-11-10-19(16-24(23)39-5-2)36-14-12-18(13-15-36)25(30)37/h6-11,16-18,27,31H,4-5,12-15H2,1-3H3,(H2,30,37)(H2,32,33,34,35) |
| InChIKey | FVKJVDMIPHVUKG-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 126.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.10 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|