C26H30ClN7O4 — CID 87055588
2-[2-[[5-chloro-2-[4-[4-(dimethylamino)piperidin-1-yl]-2-methoxyanilino]pyrimidin-4-yl]amino]phenyl]-N-hydroxy-2-oxoacetamide (PubChem CID 87055588) has the molecular formula C26H30ClN7O4 and a molecular weight of 540.02 g/mol. Its IUPAC name is 2-[2-[[5-chloro-2-[4-[4-(dimethylamino)piperidin-1-yl]-2-methoxyanilino]pyrimidin-4-yl]amino]phenyl]-N-hydroxy-2-oxoacetamide.
| Compound Name | 2-[2-[[5-chloro-2-[4-[4-(dimethylamino)piperidin-1-yl]-2-methoxyanilino]pyrimidin-4-yl]amino]phenyl]-N-hydroxy-2-oxoacetamide |
|---|---|
| PubChem CID | 87055588 |
| Molecular Formula | C26H30ClN7O4 |
| Molecular Weight | 540.02 g/mol |
| Exact Mass | 539.20 |
| IUPAC Name | 2-[2-[[5-chloro-2-[4-[4-(dimethylamino)piperidin-1-yl]-2-methoxyanilino]pyrimidin-4-yl]amino]phenyl]-N-hydroxy-2-oxoacetamide |
| SMILES | COc1cc(N2CCC(N(C)C)CC2)ccc1Nc1ncc(Cl)c(Nc2ccccc2C(=O)C(=O)NO)n1 |
| InChI | InChI=1S/C26H30ClN7O4/c1-33(2)16-10-12-34(13-11-16)17-8-9-21(22(14-17)38-3)30-26-28-15-19(27)24(31-26)29-20-7-5-4-6-18(20)23(35)25(36)32-37/h4-9,14-16,37H,10-13H2,1-3H3,(H,32,36)(H2,28,29,30,31) |
| InChIKey | JLFPEHXJEYWJFT-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 131.95 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.02 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|