C27H34ClN8O3S- — CID 170309977
5-chloro-2-[2-methoxy-4-[4-(4-methylpiperazin-1-yl)piperidin-1-yl]anilino]-4-[2-(sulfinatoamino)anilino]pyrimidine (PubChem CID 170309977) has the molecular formula C27H34ClN8O3S- and a molecular weight of 586.14 g/mol. Its IUPAC name is 5-chloro-2-[2-methoxy-4-[4-(4-methylpiperazin-1-yl)piperidin-1-yl]anilino]-4-[2-(sulfinatoamino)anilino]pyrimidine.
| Compound Name | 5-chloro-2-[2-methoxy-4-[4-(4-methylpiperazin-1-yl)piperidin-1-yl]anilino]-4-[2-(sulfinatoamino)anilino]pyrimidine |
|---|---|
| PubChem CID | 170309977 |
| Molecular Formula | C27H34ClN8O3S- |
| Molecular Weight | 586.14 g/mol |
| Exact Mass | 585.22 |
| IUPAC Name | 5-chloro-2-[2-methoxy-4-[4-(4-methylpiperazin-1-yl)piperidin-1-yl]anilino]-4-[2-(sulfinatoamino)anilino]pyrimidine |
| SMILES | COc1cc(N2CCC(N3CCN(C)CC3)CC2)ccc1Nc1ncc(Cl)c(Nc2ccccc2NS(=O)[O-])n1 |
| InChI | InChI=1S/C27H35ClN8O3S/c1-34-13-15-36(16-14-34)19-9-11-35(12-10-19)20-7-8-24(25(17-20)39-2)31-27-29-18-21(28)26(32-27)30-22-5-3-4-6-23(22)33-40(37)38/h3-8,17-19,33H,9-16H2,1-2H3,(H,37,38)(H2,29,30,31,32)/p-1 |
| InChIKey | ITMQTUMWCHFXRT-UHFFFAOYSA-M |
| XLogP | 4.05 |
| TPSA | 120.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.14 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|