C29H37ClN7O2P — CID 166947531
4-[1-[4-[[5-chloro-4-(2-dimethylphosphanylanilino)pyrimidin-2-yl]amino]-3-methoxyphenyl]piperidin-4-yl]piperazine-1-carbaldehyde (PubChem CID 166947531) has the molecular formula C29H37ClN7O2P and a molecular weight of 582.09 g/mol. Its IUPAC name is 4-[1-[4-[[5-chloro-4-(2-dimethylphosphanylanilino)pyrimidin-2-yl]amino]-3-methoxyphenyl]piperidin-4-yl]piperazine-1-carbaldehyde.
| Compound Name | 4-[1-[4-[[5-chloro-4-(2-dimethylphosphanylanilino)pyrimidin-2-yl]amino]-3-methoxyphenyl]piperidin-4-yl]piperazine-1-carbaldehyde |
|---|---|
| PubChem CID | 166947531 |
| Molecular Formula | C29H37ClN7O2P |
| Molecular Weight | 582.09 g/mol |
| Exact Mass | 581.24 |
| IUPAC Name | 4-[1-[4-[[5-chloro-4-(2-dimethylphosphanylanilino)pyrimidin-2-yl]amino]-3-methoxyphenyl]piperidin-4-yl]piperazine-1-carbaldehyde |
| SMILES | COc1cc(N2CCC(N3CCN(C=O)CC3)CC2)ccc1Nc1ncc(Cl)c(Nc2ccccc2P(C)C)n1 |
| InChI | InChI=1S/C29H37ClN7O2P/c1-39-26-18-22(36-12-10-21(11-13-36)37-16-14-35(20-38)15-17-37)8-9-24(26)33-29-31-19-23(30)28(34-29)32-25-6-4-5-7-27(25)40(2)3/h4-9,18-21H,10-17H2,1-3H3,(H2,31,32,33,34) |
| InChIKey | XNOTZSKQWWADQX-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 85.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.09 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|