C28H37ClN8O3S — CID 170309893
5-chloro-2-[2-methoxy-4-[4-(1-methylpiperidin-4-yl)piperazin-1-yl]anilino]-4-[2-[(sulfinoamino)methyl]anilino]pyrimidine (PubChem CID 170309893) has the molecular formula C28H37ClN8O3S and a molecular weight of 601.18 g/mol. Its IUPAC name is 5-chloro-2-[2-methoxy-4-[4-(1-methylpiperidin-4-yl)piperazin-1-yl]anilino]-4-[2-[(sulfinoamino)methyl]anilino]pyrimidine.
| Compound Name | 5-chloro-2-[2-methoxy-4-[4-(1-methylpiperidin-4-yl)piperazin-1-yl]anilino]-4-[2-[(sulfinoamino)methyl]anilino]pyrimidine |
|---|---|
| PubChem CID | 170309893 |
| Molecular Formula | C28H37ClN8O3S |
| Molecular Weight | 601.18 g/mol |
| Exact Mass | 600.24 |
| IUPAC Name | 5-chloro-2-[2-methoxy-4-[4-(1-methylpiperidin-4-yl)piperazin-1-yl]anilino]-4-[2-[(sulfinoamino)methyl]anilino]pyrimidine |
| SMILES | COc1cc(N2CCN(C3CCN(C)CC3)CC2)ccc1Nc1ncc(Cl)c(Nc2ccccc2CNS(=O)O)n1 |
| InChI | InChI=1S/C28H37ClN8O3S/c1-35-11-9-21(10-12-35)36-13-15-37(16-14-36)22-7-8-25(26(17-22)40-2)33-28-30-19-23(29)27(34-28)32-24-6-4-3-5-20(24)18-31-41(38)39/h3-8,17,19,21,31H,9-16,18H2,1-2H3,(H,38,39)(H2,30,32,33,34) |
| InChIKey | DPWHNAAEGKRBSE-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 118.12 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 601.18 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|