C24H28ClN6O3S- — CID 170310045
5-chloro-2-[2-methoxy-4-(1-methylpiperidin-4-yl)anilino]-4-[2-[(sulfinatoamino)methyl]anilino]pyrimidine (PubChem CID 170310045) has the molecular formula C24H28ClN6O3S- and a molecular weight of 516.05 g/mol. Its IUPAC name is 5-chloro-2-[2-methoxy-4-(1-methylpiperidin-4-yl)anilino]-4-[2-[(sulfinatoamino)methyl]anilino]pyrimidine.
| Compound Name | 5-chloro-2-[2-methoxy-4-(1-methylpiperidin-4-yl)anilino]-4-[2-[(sulfinatoamino)methyl]anilino]pyrimidine |
|---|---|
| PubChem CID | 170310045 |
| Molecular Formula | C24H28ClN6O3S- |
| Molecular Weight | 516.05 g/mol |
| Exact Mass | 515.16 |
| IUPAC Name | 5-chloro-2-[2-methoxy-4-(1-methylpiperidin-4-yl)anilino]-4-[2-[(sulfinatoamino)methyl]anilino]pyrimidine |
| SMILES | COc1cc(C2CCN(C)CC2)ccc1Nc1ncc(Cl)c(Nc2ccccc2CNS(=O)[O-])n1 |
| InChI | InChI=1S/C24H29ClN6O3S/c1-31-11-9-16(10-12-31)17-7-8-21(22(13-17)34-2)29-24-26-15-19(25)23(30-24)28-20-6-4-3-5-18(20)14-27-35(32)33/h3-8,13,15-16,27H,9-12,14H2,1-2H3,(H,32,33)(H2,26,28,29,30)/p-1 |
| InChIKey | PCUQJUPEAGRYLZ-UHFFFAOYSA-M |
| XLogP | 4.32 |
| TPSA | 114.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.05 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|