C23H25F3N7O3S- — CID 170310251
2-(2-methoxy-4-piperazin-1-ylanilino)-4-[2-[(sulfinatoamino)methyl]anilino]-5-(trifluoromethyl)pyrimidine (PubChem CID 170310251) has the molecular formula C23H25F3N7O3S- and a molecular weight of 536.56 g/mol. Its IUPAC name is 2-(2-methoxy-4-piperazin-1-ylanilino)-4-[2-[(sulfinatoamino)methyl]anilino]-5-(trifluoromethyl)pyrimidine.
| Compound Name | 2-(2-methoxy-4-piperazin-1-ylanilino)-4-[2-[(sulfinatoamino)methyl]anilino]-5-(trifluoromethyl)pyrimidine |
|---|---|
| PubChem CID | 170310251 |
| Molecular Formula | C23H25F3N7O3S- |
| Molecular Weight | 536.56 g/mol |
| Exact Mass | 536.17 |
| IUPAC Name | 2-(2-methoxy-4-piperazin-1-ylanilino)-4-[2-[(sulfinatoamino)methyl]anilino]-5-(trifluoromethyl)pyrimidine |
| SMILES | COc1cc(N2CCNCC2)ccc1Nc1ncc(C(F)(F)F)c(Nc2ccccc2CNS(=O)[O-])n1 |
| InChI | InChI=1S/C23H26F3N7O3S/c1-36-20-12-16(33-10-8-27-9-11-33)6-7-19(20)31-22-28-14-17(23(24,25)26)21(32-22)30-18-5-3-2-4-15(18)13-29-37(34)35/h2-7,12,14,27,29H,8-11,13H2,1H3,(H,34,35)(H2,28,30,31,32)/p-1 |
| InChIKey | ZKOCABSRWUTKEX-UHFFFAOYSA-M |
| XLogP | 3.28 |
| TPSA | 126.50 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.56 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|