C27H35ClN8O3S — CID 170310176
5-chloro-2-[2-methoxy-4-(4-piperidin-4-ylpiperazin-1-yl)anilino]-4-[2-[(sulfinoamino)methyl]anilino]pyrimidine (PubChem CID 170310176) has the molecular formula C27H35ClN8O3S and a molecular weight of 587.15 g/mol. Its IUPAC name is 5-chloro-2-[2-methoxy-4-(4-piperidin-4-ylpiperazin-1-yl)anilino]-4-[2-[(sulfinoamino)methyl]anilino]pyrimidine.
| Compound Name | 5-chloro-2-[2-methoxy-4-(4-piperidin-4-ylpiperazin-1-yl)anilino]-4-[2-[(sulfinoamino)methyl]anilino]pyrimidine |
|---|---|
| PubChem CID | 170310176 |
| Molecular Formula | C27H35ClN8O3S |
| Molecular Weight | 587.15 g/mol |
| Exact Mass | 586.22 |
| IUPAC Name | 5-chloro-2-[2-methoxy-4-(4-piperidin-4-ylpiperazin-1-yl)anilino]-4-[2-[(sulfinoamino)methyl]anilino]pyrimidine |
| SMILES | COc1cc(N2CCN(C3CCNCC3)CC2)ccc1Nc1ncc(Cl)c(Nc2ccccc2CNS(=O)O)n1 |
| InChI | InChI=1S/C27H35ClN8O3S/c1-39-25-16-21(36-14-12-35(13-15-36)20-8-10-29-11-9-20)6-7-24(25)33-27-30-18-22(28)26(34-27)32-23-5-3-2-4-19(23)17-31-40(37)38/h2-7,16,18,20,29,31H,8-15,17H2,1H3,(H,37,38)(H2,30,32,33,34) |
| InChIKey | SNFNGBKCNYKIPB-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 126.91 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 587.15 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|