C23H28ClN6O2P — CID 175543402
5-chloro-4-N-(2-dimethylphosphanyloxyphenyl)-2-N-(2-methoxy-4-piperazin-1-ylphenyl)pyrimidine-2,4-diamine (PubChem CID 175543402) has the molecular formula C23H28ClN6O2P and a molecular weight of 486.94 g/mol. Its IUPAC name is 5-chloro-4-N-(2-dimethylphosphanyloxyphenyl)-2-N-(2-methoxy-4-piperazin-1-ylphenyl)pyrimidine-2,4-diamine.
| Compound Name | 5-chloro-4-N-(2-dimethylphosphanyloxyphenyl)-2-N-(2-methoxy-4-piperazin-1-ylphenyl)pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 175543402 |
| Molecular Formula | C23H28ClN6O2P |
| Molecular Weight | 486.94 g/mol |
| Exact Mass | 486.17 |
| IUPAC Name | 5-chloro-4-N-(2-dimethylphosphanyloxyphenyl)-2-N-(2-methoxy-4-piperazin-1-ylphenyl)pyrimidine-2,4-diamine |
| SMILES | COc1cc(N2CCNCC2)ccc1Nc1ncc(Cl)c(Nc2ccccc2OP(C)C)n1 |
| InChI | InChI=1S/C23H28ClN6O2P/c1-31-21-14-16(30-12-10-25-11-13-30)8-9-19(21)28-23-26-15-17(24)22(29-23)27-18-6-4-5-7-20(18)32-33(2)3/h4-9,14-15,25H,10-13H2,1-3H3,(H2,26,27,28,29) |
| InChIKey | UKOPUJIAKWDREP-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 83.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.94 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|