C28H36ClIN6O2P+ — CID 129110471
[2-[[5-chloro-2-[4-(3,9-diazaspiro[5.5]undecan-3-yl)-2-methoxyanilino]pyrimidin-4-yl]amino]phenyl]-iodooxy-dimethylphosphanium (PubChem CID 129110471) has the molecular formula C28H36ClIN6O2P+ and a molecular weight of 681.97 g/mol. Its IUPAC name is [2-[[5-chloro-2-[4-(3,9-diazaspiro[5.5]undecan-3-yl)-2-methoxyanilino]pyrimidin-4-yl]amino]phenyl]-iodooxy-dimethylphosphanium.
| Compound Name | [2-[[5-chloro-2-[4-(3,9-diazaspiro[5.5]undecan-3-yl)-2-methoxyanilino]pyrimidin-4-yl]amino]phenyl]-iodooxy-dimethylphosphanium |
|---|---|
| PubChem CID | 129110471 |
| Molecular Formula | C28H36ClIN6O2P+ |
| Molecular Weight | 681.97 g/mol |
| Exact Mass | 681.14 |
| IUPAC Name | [2-[[5-chloro-2-[4-(3,9-diazaspiro[5.5]undecan-3-yl)-2-methoxyanilino]pyrimidin-4-yl]amino]phenyl]-iodooxy-dimethylphosphanium |
| SMILES | COc1cc(N2CCC3(CCNCC3)CC2)ccc1Nc1ncc(Cl)c(Nc2ccccc2[P+](C)(C)OI)n1 |
| InChI | InChI=1S/C28H36ClIN6O2P/c1-37-24-18-20(36-16-12-28(13-17-36)10-14-31-15-11-28)8-9-22(24)34-27-32-19-21(29)26(35-27)33-23-6-4-5-7-25(23)39(2,3)38-30/h4-9,18-19,31H,10-17H2,1-3H3,(H2,32,33,34,35)/q+1 |
| InChIKey | WHAMBVKSGDADQU-UHFFFAOYSA-N |
| XLogP | 6.78 |
| TPSA | 83.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 681.97 |
| LogP ≤ 5 | 6.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|