C22H24Cl2N6O3 — CID 141427231
2-N-(5-amino-4-chloro-2-methoxyphenyl)-5-chloro-4-N-(2-methoxy-4-morpholin-4-ylphenyl)pyrimidine-2,4-diamine (PubChem CID 141427231) has the molecular formula C22H24Cl2N6O3 and a molecular weight of 491.38 g/mol. Its IUPAC name is 2-N-(5-amino-4-chloro-2-methoxyphenyl)-5-chloro-4-N-(2-methoxy-4-morpholin-4-ylphenyl)pyrimidine-2,4-diamine.
| Compound Name | 2-N-(5-amino-4-chloro-2-methoxyphenyl)-5-chloro-4-N-(2-methoxy-4-morpholin-4-ylphenyl)pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 141427231 |
| Molecular Formula | C22H24Cl2N6O3 |
| Molecular Weight | 491.38 g/mol |
| Exact Mass | 490.13 |
| IUPAC Name | 2-N-(5-amino-4-chloro-2-methoxyphenyl)-5-chloro-4-N-(2-methoxy-4-morpholin-4-ylphenyl)pyrimidine-2,4-diamine |
| SMILES | COc1cc(Cl)c(N)cc1Nc1ncc(Cl)c(Nc2ccc(N3CCOCC3)cc2OC)n1 |
| InChI | InChI=1S/C22H24Cl2N6O3/c1-31-19-9-13(30-5-7-33-8-6-30)3-4-17(19)27-21-15(24)12-26-22(29-21)28-18-11-16(25)14(23)10-20(18)32-2/h3-4,9-12H,5-8,25H2,1-2H3,(H2,26,27,28,29) |
| InChIKey | YXPRILPOTPAISY-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 106.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.38 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|