C21H21ClN6O5S — CID 174997403
carbamoyl 2-[[5-chloro-2-(2-methoxy-5-morpholin-4-ylanilino)pyrimidin-4-yl]amino]thiophene-3-carboxylate (PubChem CID 174997403) has the molecular formula C21H21ClN6O5S and a molecular weight of 504.96 g/mol. Its IUPAC name is carbamoyl 2-[[5-chloro-2-(2-methoxy-5-morpholin-4-ylanilino)pyrimidin-4-yl]amino]thiophene-3-carboxylate.
| Compound Name | carbamoyl 2-[[5-chloro-2-(2-methoxy-5-morpholin-4-ylanilino)pyrimidin-4-yl]amino]thiophene-3-carboxylate |
|---|---|
| PubChem CID | 174997403 |
| Molecular Formula | C21H21ClN6O5S |
| Molecular Weight | 504.96 g/mol |
| Exact Mass | 504.10 |
| IUPAC Name | carbamoyl 2-[[5-chloro-2-(2-methoxy-5-morpholin-4-ylanilino)pyrimidin-4-yl]amino]thiophene-3-carboxylate |
| SMILES | COc1ccc(N2CCOCC2)cc1Nc1ncc(Cl)c(Nc2sccc2C(=O)OC(N)=O)n1 |
| InChI | InChI=1S/C21H21ClN6O5S/c1-31-16-3-2-12(28-5-7-32-8-6-28)10-15(16)25-21-24-11-14(22)17(27-21)26-18-13(4-9-34-18)19(29)33-20(23)30/h2-4,9-11H,5-8H2,1H3,(H2,23,30)(H2,24,25,26,27) |
| InChIKey | JSLBNLQBPQVBCV-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 140.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.96 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|