C22H24N6O3 — CID 117077407
2-[[5-methoxy-2-(4-morpholin-4-ylanilino)pyrimidin-4-yl]amino]benzamide (PubChem CID 117077407) has the molecular formula C22H24N6O3 and a molecular weight of 420.47 g/mol. Its IUPAC name is 2-[[5-methoxy-2-(4-morpholin-4-ylanilino)pyrimidin-4-yl]amino]benzamide.
| Compound Name | 2-[[5-methoxy-2-(4-morpholin-4-ylanilino)pyrimidin-4-yl]amino]benzamide |
|---|---|
| PubChem CID | 117077407 |
| Molecular Formula | C22H24N6O3 |
| Molecular Weight | 420.47 g/mol |
| Exact Mass | 420.19 |
| IUPAC Name | 2-[[5-methoxy-2-(4-morpholin-4-ylanilino)pyrimidin-4-yl]amino]benzamide |
| SMILES | COc1cnc(Nc2ccc(N3CCOCC3)cc2)nc1Nc1ccccc1C(N)=O |
| InChI | InChI=1S/C22H24N6O3/c1-30-19-14-24-22(27-21(19)26-18-5-3-2-4-17(18)20(23)29)25-15-6-8-16(9-7-15)28-10-12-31-13-11-28/h2-9,14H,10-13H2,1H3,(H2,23,29)(H2,24,25,26,27) |
| InChIKey | XRJQJQCDDXGOOP-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 114.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.47 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|