C22H22ClFN6O3 — CID 172553198
2-[[5-chloro-2-(3-fluoro-4-morpholin-4-ylanilino)pyrimidin-4-yl]amino]-N-methoxybenzamide (PubChem CID 172553198) has the molecular formula C22H22ClFN6O3 and a molecular weight of 472.91 g/mol. Its IUPAC name is 2-[[5-chloro-2-(3-fluoro-4-morpholin-4-ylanilino)pyrimidin-4-yl]amino]-N-methoxybenzamide.
| Compound Name | 2-[[5-chloro-2-(3-fluoro-4-morpholin-4-ylanilino)pyrimidin-4-yl]amino]-N-methoxybenzamide |
|---|---|
| PubChem CID | 172553198 |
| Molecular Formula | C22H22ClFN6O3 |
| Molecular Weight | 472.91 g/mol |
| Exact Mass | 472.14 |
| IUPAC Name | 2-[[5-chloro-2-(3-fluoro-4-morpholin-4-ylanilino)pyrimidin-4-yl]amino]-N-methoxybenzamide |
| SMILES | CONC(=O)c1ccccc1Nc1nc(Nc2ccc(N3CCOCC3)c(F)c2)ncc1Cl |
| InChI | InChI=1S/C22H22ClFN6O3/c1-32-29-21(31)15-4-2-3-5-18(15)27-20-16(23)13-25-22(28-20)26-14-6-7-19(17(24)12-14)30-8-10-33-11-9-30/h2-7,12-13H,8-11H2,1H3,(H,29,31)(H2,25,26,27,28) |
| InChIKey | HUZDWWKYXQRNNS-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 100.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.91 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|