C25H28ClN7O3 — CID 87055100
2-[2-[[5-chloro-2-[3-methoxy-4-(4-methylpiperazin-1-yl)anilino]pyrimidin-4-yl]amino]phenyl]-N-methyl-2-oxoacetamide (PubChem CID 87055100) has the molecular formula C25H28ClN7O3 and a molecular weight of 510.00 g/mol. Its IUPAC name is 2-[2-[[5-chloro-2-[3-methoxy-4-(4-methylpiperazin-1-yl)anilino]pyrimidin-4-yl]amino]phenyl]-N-methyl-2-oxoacetamide.
| Compound Name | 2-[2-[[5-chloro-2-[3-methoxy-4-(4-methylpiperazin-1-yl)anilino]pyrimidin-4-yl]amino]phenyl]-N-methyl-2-oxoacetamide |
|---|---|
| PubChem CID | 87055100 |
| Molecular Formula | C25H28ClN7O3 |
| Molecular Weight | 510.00 g/mol |
| Exact Mass | 509.19 |
| IUPAC Name | 2-[2-[[5-chloro-2-[3-methoxy-4-(4-methylpiperazin-1-yl)anilino]pyrimidin-4-yl]amino]phenyl]-N-methyl-2-oxoacetamide |
| SMILES | CNC(=O)C(=O)c1ccccc1Nc1nc(Nc2ccc(N3CCN(C)CC3)c(OC)c2)ncc1Cl |
| InChI | InChI=1S/C25H28ClN7O3/c1-27-24(35)22(34)17-6-4-5-7-19(17)30-23-18(26)15-28-25(31-23)29-16-8-9-20(21(14-16)36-3)33-12-10-32(2)11-13-33/h4-9,14-15H,10-13H2,1-3H3,(H,27,35)(H2,28,29,30,31) |
| InChIKey | UBPDOQYPGGLAJG-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 111.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.00 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|