C28H36ClN6O2P — CID 175205734
5-chloro-4-N-(2-dimethylphosphorylphenyl)-2-N-[3-methoxy-4-(4-pyrrolidin-1-ylpiperidin-1-yl)phenyl]pyrimidine-2,4-diamine (PubChem CID 175205734) has the molecular formula C28H36ClN6O2P and a molecular weight of 555.06 g/mol. Its IUPAC name is 5-chloro-4-N-(2-dimethylphosphorylphenyl)-2-N-[3-methoxy-4-(4-pyrrolidin-1-ylpiperidin-1-yl)phenyl]pyrimidine-2,4-diamine.
| Compound Name | 5-chloro-4-N-(2-dimethylphosphorylphenyl)-2-N-[3-methoxy-4-(4-pyrrolidin-1-ylpiperidin-1-yl)phenyl]pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 175205734 |
| Molecular Formula | C28H36ClN6O2P |
| Molecular Weight | 555.06 g/mol |
| Exact Mass | 554.23 |
| IUPAC Name | 5-chloro-4-N-(2-dimethylphosphorylphenyl)-2-N-[3-methoxy-4-(4-pyrrolidin-1-ylpiperidin-1-yl)phenyl]pyrimidine-2,4-diamine |
| SMILES | COc1cc(Nc2ncc(Cl)c(Nc3ccccc3P(C)(C)=O)n2)ccc1N1CCC(N2CCCC2)CC1 |
| InChI | InChI=1S/C28H36ClN6O2P/c1-37-25-18-20(10-11-24(25)35-16-12-21(13-17-35)34-14-6-7-15-34)31-28-30-19-22(29)27(33-28)32-23-8-4-5-9-26(23)38(2,3)36/h4-5,8-11,18-19,21H,6-7,12-17H2,1-3H3,(H2,30,31,32,33) |
| InChIKey | QVIRUBUMWDAZPW-UHFFFAOYSA-N |
| XLogP | 5.94 |
| TPSA | 82.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.06 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|